cas: 83548-46-3 — see every product listed under this CAS number, including other names
(S)-2,3-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester, 95%, 95% (CAS 83548-46-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3XJ-100mg |
| cas | 83548-46-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 1g | 1648.40 Pln | |
| Chemat | 5g | 5987.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate (CAS 83548-46-3) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: WGCPPYJWSDCBNC-QMMMGPOBSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | WGCPPYJWSDCBNC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)