cas: 1251903-93-1 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 98% (CAS 1251903-93-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225978-250MG |
| cas | 1251903-93-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1658.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride (CAS 1251903-93-1) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: MESGHYLTRXYTHM-QRPNPIFTSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride |
| InChIKey | MESGHYLTRXYTHM-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)