CAS 1217446-43-9 appears in our catalog under these names: (2R,4S)–1–tert–Butyl 2–methyl 4–aminopyrrolidine–1,2–dicarboxylate hydrochloride, 1-tert-butyl 2-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, (2R,4S)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, 95%, 95%, (2R,4S)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 50g, 100mg.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 1217446-43-9) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: KFYCQKLSGMAVQH-KZYPOYLOSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | KFYCQKLSGMAVQH-KZYPOYLOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)N.Cl |
Computed by PubChem (NCBI)