cas: 35726-62-6 — see every product listed under this CAS number, including other names
(S)-2-(((Benzyloxy)carbonyl)amino)-5-ethoxy-5-oxopentanoic acid, 97% (CAS 35726-62-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD16052-1g |
| cas | 35726-62-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 1g | 131.09 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 553.16 Pln | |
| BLDpharm | 25g | 919.70 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 846.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 35726-62-6) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: (2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: HRFYEAOTNUSCGI-LBPRGKRZSA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | (2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HRFYEAOTNUSCGI-LBPRGKRZSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)