Products 96258-91-2
CAS 96258-91-2 is the registry number for 2-((2-Methoxyacetyl)(2-methoxy-1-methyl-2-oxoethyl)amino)-3-methylbenzoic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-[(2-methoxyacetyl)-(1-methoxy-1-oxopropan-2-yl)amino]-3-methylbenzoic acid (CAS 96258-91-2) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: 2-[(2-methoxyacetyl)-(1-methoxy-1-oxopropan-2-yl)amino]-3-methylbenzoic acid. InChIKey: ZIJPHUJGSWQIHU-UHFFFAOYSA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | 2-[(2-methoxyacetyl)-(1-methoxy-1-oxopropan-2-yl)amino]-3-methylbenzoic acid |
| InChIKey | ZIJPHUJGSWQIHU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)N(C(C)C(=O)OC)C(=O)COC |
Computed by PubChem (NCBI)