Products 1177274-36-0

CAS 1177274-36-0 is the registry number for 2-(2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)piperidine oxalate, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine;oxalic acid (CAS 1177274-36-0) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine;oxalic acid. InChIKey: YNADEKIGGFGRKE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO6
Molecular weight309.31 g/mol
IUPAC name2-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine;oxalic acid
InChIKeyYNADEKIGGFGRKE-UHFFFAOYSA-N
SMILESC1CCNC(C1)C2=CC3=C(C=C2)OCCO3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)