CAS 186689-03-2 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-formyl-4-hydroxyphenyl)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(2S)-3-(3-formyl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 186689-03-2) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: (2S)-3-(3-formyl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DCYKYFMFAFQHSE-NSHDSACASA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | (2S)-3-(3-formyl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DCYKYFMFAFQHSE-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)O)C=O)C(=O)O |
Computed by PubChem (NCBI)