Products 55894-52-5
CAS 55894-52-5 appears in our catalog under these names: NOBA, 4-Nitro-3-[(1-Oxooctyl)Oxy]Benzoic Acid, 95%, 95%, NOBA, 98.61%, 4-NITRO-3-(OCTANOYLOXY)BENZOIC ACID, 95%, NOB, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 250 mg, 50 mg, 100 mg.
4-nitro-3-octanoyloxybenzoic acid (CAS 55894-52-5) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: 4-nitro-3-octanoyloxybenzoic acid. InChIKey: VDCATWRTRISVBZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | 4-nitro-3-octanoyloxybenzoic acid |
| InChIKey | VDCATWRTRISVBZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)