Products 77856-51-0

CAS 77856-51-0 is the registry number for dimethyl 3–(benzyloxycarbonylamino)pentanedioate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 3-(phenylmethoxycarbonylamino)pentanedioate (CAS 77856-51-0) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: dimethyl 3-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: GCARTCPMCGRKDU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO6
Molecular weight309.31 g/mol
IUPAC namedimethyl 3-(phenylmethoxycarbonylamino)pentanedioate
InChIKeyGCARTCPMCGRKDU-UHFFFAOYSA-N
SMILESCOC(=O)CC(CC(=O)OC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)