cas: 201594-84-5 — see every product listed under this CAS number, including other names
(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine 98% (CAS 201594-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143772-100g |
| cas | 201594-84-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3991.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1293.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143772 |
2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine (CAS 201594-84-5) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine. InChIKey: OTZYADIPHOGUDN-KRWDZBQOSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-[(S)-(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine |
| InChIKey | OTZYADIPHOGUDN-KRWDZBQOSA-N |
| SMILES | C1CNCCC1O[C@@H](C2=CC=C(C=C2)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)