cas: 162537-11-3 — see every product listed under this CAS number, including other names
(S)-2-((Methoxycarbonyl)amino)-3,3-dimethylbutanoic acid, 97%, 97% (CAS 162537-11-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112T9V-5g |
| cas | 162537-11-3 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 417.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 162537-11-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: NWPRXAIYBULIEI-RXMQYKEDSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | NWPRXAIYBULIEI-RXMQYKEDSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)