cas: 162537-11-3 — see every product listed under this CAS number, including other names
(S)-2-(Methoxycarbonylamino)-3,3-dimethylbutanoic acid, 98.0% (CAS 162537-11-3) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-59135-500 g |
| cas | 162537-11-3 |
| size | 500 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 1072.02 Pln | |
| MedChemExpress | 100 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 162537-11-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: NWPRXAIYBULIEI-RXMQYKEDSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | NWPRXAIYBULIEI-RXMQYKEDSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)