cas: 45214-91-3 — see every product listed under this CAS number, including other names
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid, 98.0% (CAS 45214-91-3) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W005143-25 g |
| cas | 45214-91-3 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 500 g | 1378.52 Pln | |
| MedChemExpress | 100 g | 575.11 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.0% |
(2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 45214-91-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OHYMUFVCRVPMEY-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OHYMUFVCRVPMEY-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)