cas: 45214-91-3 — see every product listed under this CAS number, including other names
Boc-Glu(OMe)-OH 97% (CAS 45214-91-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154814-10g |
| cas | 45214-91-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 437.12 Pln | |
| Ambeed | 500g | 1076.81 Pln | |
| Ambeed | 1000g | 2078.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154814 |
(2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 45214-91-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OHYMUFVCRVPMEY-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OHYMUFVCRVPMEY-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)