cas: 45214-91-3 — see every product listed under this CAS number, including other names
Boc-Glu(OMe)-OH, 95% (CAS 45214-91-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221991-10G |
| cas | 45214-91-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 279.09 Pln | |
| Fluorochem | 500g | 1060.06 Pln | |
| Fluorochem | 1kg | 1986.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 45214-91-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OHYMUFVCRVPMEY-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OHYMUFVCRVPMEY-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)