cas: 154598-58-0 — see every product listed under this CAS number, including other names
(S)-2-(2-AMINO-5-CHLOROPHENYL)-4-CYCLOPROPYL-1,1,1-TRIFLUOROBUT-3-YN-2-OL, 96%, 96% (CAS 154598-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11B9T5-100mg |
| cas | 154598-58-0 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 8656.40 Pln | |
| Chemat | 250mg | 12338.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (CAS 154598-58-0) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol. InChIKey: KEMUGFRERPPUHB-LBPRGKRZSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| InChIKey | KEMUGFRERPPUHB-LBPRGKRZSA-N |
| SMILES | C1CC1C#C[C@](C2=C(C=CC(=C2)Cl)N)(C(F)(F)F)O |
Computed by PubChem (NCBI)