Products 1024394-74-8
CAS 1024394-74-8 is the registry number for 2-Chloro-3-((3-(trifluoromethyl)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-chloro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one (CAS 1024394-74-8) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: 2-chloro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one. InChIKey: QMVZYMDOJNGYJB-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | 2-chloro-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one |
| InChIKey | QMVZYMDOJNGYJB-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)Cl)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)