CAS 1217863-05-2 appears in our catalog under these names: 3-((4-Chloro-2-(trifluoromethyl)phenyl)amino)cyclohex-2-enone, 97%, 3-([4-Chloro-2-(trifluoromethyl)phenyl]amino)cyclohex-2-en-1-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-[4-chloro-2-(trifluoromethyl)anilino]cyclohex-2-en-1-one (CAS 1217863-05-2) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: 3-[4-chloro-2-(trifluoromethyl)anilino]cyclohex-2-en-1-one. InChIKey: YEFXYDRSQIYIFH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | 3-[4-chloro-2-(trifluoromethyl)anilino]cyclohex-2-en-1-one |
| InChIKey | YEFXYDRSQIYIFH-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=C(C=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)