Products 1431964-47-4
CAS 1431964-47-4 is the registry number for 2-Phenoxy-5-(trifluoromethyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-phenoxy-5-(trifluoromethyl)aniline;hydrochloride (CAS 1431964-47-4) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: 2-phenoxy-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: NMZQJENEWMVEAI-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | 2-phenoxy-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | NMZQJENEWMVEAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)