CAS 154598-58-0 appears in our catalog under these names: Efavirenz Aminoalcohol, (S)-2-(2-AMINO-5-CHLOROPHENYL)-4-CYCLOPROPYL-1,1,1-TRIFLUOROBUT-3-YN-2-OL, 96%, 96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (CAS 154598-58-0) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol. InChIKey: KEMUGFRERPPUHB-LBPRGKRZSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| InChIKey | KEMUGFRERPPUHB-LBPRGKRZSA-N |
| SMILES | C1CC1C#C[C@](C2=C(C=CC(=C2)Cl)N)(C(F)(F)F)O |
Computed by PubChem (NCBI)