CAS 1197234-79-9 is the registry number for 4'-Trifluoromethoxy-biphenyl-4-ylamine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-[4-(trifluoromethoxy)phenyl]aniline;hydrochloride (CAS 1197234-79-9) is a chemical compound with the molecular formula C13H11ClF3NO and a molecular weight of 289.68 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]aniline;hydrochloride. InChIKey: UNPGEDRKQMWGQG-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3NO |
|---|---|
| Molecular weight | 289.68 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]aniline;hydrochloride |
| InChIKey | UNPGEDRKQMWGQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)