cas: 59724-73-1 — see every product listed under this CAS number, including other names
(S)-2-(4-Methoxyphenylsulfonamido)propanoic acid, ≥97%, ≥97% (CAS 59724-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAVQ-1g |
| cas | 59724-73-1 |
| size | 1g |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1278.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-[(4-methoxyphenyl)sulfonylamino]propanoic acid (CAS 59724-73-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid. InChIKey: XTCIPBHRVYICGT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| InChIKey | XTCIPBHRVYICGT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)