CAS 59724-72-0 appears in our catalog under these names: N-[(4-Methoxyphenyl)sulfonyl]-beta-alanine, 95%, N-((4-Methoxyphenyl)sulfonyl)-beta-alanine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(4-methoxyphenyl)sulfonylamino]propanoic acid (CAS 59724-72-0) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 3-[(4-methoxyphenyl)sulfonylamino]propanoic acid. InChIKey: KBHUTIQWIYFYFA-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 3-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| InChIKey | KBHUTIQWIYFYFA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)