CAS 59724-73-1 appears in our catalog under these names: 2-([(4-Methoxyphenyl)sulfonyl]amino)propanoic acid, 95%, (S)-2-(4-Methoxyphenylsulfonamido)propanoic acid, ≥97%, ≥97%, 2-(4-Methoxy-benzenesulfonylamino)-propionic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g.
2-[(4-methoxyphenyl)sulfonylamino]propanoic acid (CAS 59724-73-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid. InChIKey: XTCIPBHRVYICGT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| InChIKey | XTCIPBHRVYICGT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)