CAS 1820617-99-9 is the registry number for 2-Isopropoxy-1-methanesulfonyl-4-nitrobenzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-methylsulfonyl-4-nitro-2-propan-2-yloxybenzene (CAS 1820617-99-9) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 1-methylsulfonyl-4-nitro-2-propan-2-yloxybenzene. InChIKey: PAVQNKZKYSWUEB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 1-methylsulfonyl-4-nitro-2-propan-2-yloxybenzene |
| InChIKey | PAVQNKZKYSWUEB-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)