Products 1204586-28-6

CAS 1204586-28-6 is the registry number for 2,5-Dioxopyrrolidin-1-yl 4-(acetylthio)butanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 4-acetylsulfanylbutanoate (CAS 1204586-28-6) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-acetylsulfanylbutanoate. InChIKey: DWKYUKDBVOLOLK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO5S
Molecular weight259.28 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 4-acetylsulfanylbutanoate
InChIKeyDWKYUKDBVOLOLK-UHFFFAOYSA-N
SMILESCC(=O)SCCCC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)