CAS 112839-95-9 appears in our catalog under these names: (S)-3-Amino-2-oxetanone p-toluenesulfonic acid salt, 95%, (S)-3-Amino-2-oxetanone p-toluenesulfonic acid salt, (S)-3-Amino-2-oxetanone p-toluenesulfonic acid salt, 95+%. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 5g, 1g, on request.
(3S)-3-aminooxetan-2-one;4-methylbenzenesulfonic acid (CAS 112839-95-9) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: (3S)-3-aminooxetan-2-one;4-methylbenzenesulfonic acid. InChIKey: AHPNSUJOZQROEQ-WNQIDUERSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | (3S)-3-aminooxetan-2-one;4-methylbenzenesulfonic acid |
| InChIKey | AHPNSUJOZQROEQ-WNQIDUERSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@@H](C(=O)O1)N |
Computed by PubChem (NCBI)