cas: 620616-08-2 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 98% (CAS 620616-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497750-100MG |
| cas | 620616-08-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 2601.19 Pln | |
| Fluorochem | 25g | 7963.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride (CAS 620616-08-2) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: QAYBZIBCNZGNDV-DDWIOCJRSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | QAYBZIBCNZGNDV-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)