CAS 1391448-75-1 appears in our catalog under these names: (2R)-2-Amino-2-(4-chlorophenyl)ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(4–chlorophenyl)ethanol hydrochloride, (2R)-2-Amino-2-(4-chlorophenyl)ethan-1-ol hydrochloride, (R)-2-Amino-2-(4-chlorophenyl)ethanol hydrochloride 95%, (R)-2-Amino-2-(4-chlorophenyl)ethanol hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g, 10g.
(2R)-2-amino-2-(4-chlorophenyl)ethanol;hydrochloride (CAS 1391448-75-1) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (2R)-2-amino-2-(4-chlorophenyl)ethanol;hydrochloride. InChIKey: JYSCNYFGCTZKFU-QRPNPIFTSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-chlorophenyl)ethanol;hydrochloride |
| InChIKey | JYSCNYFGCTZKFU-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)