CAS 82171-33-3 appears in our catalog under these names: 2-Amino-1-(3-chlorophenyl)ethan-1-ol hydrochloride, 95%, 2-Amino-1-(3-chlorophenyl)ethan-1-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-amino-1-(3-chlorophenyl)ethanol;hydrochloride (CAS 82171-33-3) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: 2-amino-1-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: KEYKAIIHCHCFEO-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | 2-amino-1-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | KEYKAIIHCHCFEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(CN)O.Cl |
Computed by PubChem (NCBI)