CAS 1245623-78-2 appears in our catalog under these names: (R)–2–Amino–2–(3–chlorophenyl)ethanol hydrochloride, (R)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 95%, (R)-2-AMINO-2-(3-CHLOROPHENYL)ETHANOL HCL, 95%, (R)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 95%, 95%, Benzeneethanol, a-amino-3-chloro-, hydrochloride (1:1), (aR)-. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2R)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride (CAS 1245623-78-2) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (2R)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: QAYBZIBCNZGNDV-QRPNPIFTSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | QAYBZIBCNZGNDV-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)