CAS 620616-08-2 appears in our catalog under these names: (S)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 95%, (S)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 98%, (S)-2-Amino-2-(3-chlorophenyl)ethanol hydrochloride, 98%, 98%, Benzeneethanol, a-amino-3-chloro-, hydrochloride (1:1), (aS)-. Offered by: Combi-blocks, Fluorochem, Chemat, Biosynth. Available pack sizes: 250mg, 25g, 1g, 5g, 100mg.
(2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride (CAS 620616-08-2) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: QAYBZIBCNZGNDV-DDWIOCJRSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | QAYBZIBCNZGNDV-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)