CAS 1334146-19-8 appears in our catalog under these names: 2-Amino-2-(3-chlorophenyl)ethan-1-ol hydrochloride, 95%, 2–Amino–2–(3–chlorophenyl)ethanol hydrochloride, 2-Amino-2-(3-chlorophenyl)ethan-1-ol hydrochloride, 2-amino-2-(3-chlorophenyl)ethan-1-ol hydrochloride, 98%, 98%, 2-AMINO-2-(3-CHLOROPHENYL)ETHANOL HCL, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10g.
2-amino-2-(3-chlorophenyl)ethanol;hydrochloride (CAS 1334146-19-8) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: 2-amino-2-(3-chlorophenyl)ethanol;hydrochloride. InChIKey: QAYBZIBCNZGNDV-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | 2-amino-2-(3-chlorophenyl)ethanol;hydrochloride |
| InChIKey | QAYBZIBCNZGNDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(CO)N.Cl |
Computed by PubChem (NCBI)