cas: 1391529-06-8 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(4-bromophenyl)acetic acid hydrochloride, 95%, 95% (CAS 1391529-06-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDN1-100mg |
| cas | 1391529-06-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 2330.00 Pln | |
| Chemat | 10g | 4077.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-2-(4-bromophenyl)acetic acid;hydrochloride (CAS 1391529-06-8) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: (2S)-2-amino-2-(4-bromophenyl)acetic acid;hydrochloride. InChIKey: WANQBUDPQVTWJW-FJXQXJEOSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-bromophenyl)acetic acid;hydrochloride |
| InChIKey | WANQBUDPQVTWJW-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)