CAS 252044-81-8 is the registry number for 2-Bromo-4-chloro-3,6-dimethoxyaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-chloro-3,6-dimethoxyaniline (CAS 252044-81-8) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: 2-bromo-4-chloro-3,6-dimethoxyaniline. InChIKey: DCZZWZZVKMIRJH-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 2-bromo-4-chloro-3,6-dimethoxyaniline |
| InChIKey | DCZZWZZVKMIRJH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1N)Br)OC)Cl |
Computed by PubChem (NCBI)