Products 1797943-61-3
CAS 1797943-61-3 appears in our catalog under these names: 6-Amino-3-bromo-2-methylbenzoic acid hydrochloride, 6-Amino-3-bromo-2-methylbenzoic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g, 100mg, 5g, 250mg, 10g.
6-amino-3-bromo-2-methylbenzoic acid;hydrochloride (CAS 1797943-61-3) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: 6-amino-3-bromo-2-methylbenzoic acid;hydrochloride. InChIKey: HLFOCBMGWOXZLO-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 6-amino-3-bromo-2-methylbenzoic acid;hydrochloride |
| InChIKey | HLFOCBMGWOXZLO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)