CAS 1803581-93-2 is the registry number for Methyl 5-amino-2-bromobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 5-amino-2-bromobenzoate;hydrochloride (CAS 1803581-93-2) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: methyl 5-amino-2-bromobenzoate;hydrochloride. InChIKey: XOLXPFZLNOUDGV-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | methyl 5-amino-2-bromobenzoate;hydrochloride |
| InChIKey | XOLXPFZLNOUDGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)Br.Cl |
Computed by PubChem (NCBI)