Products 1803581-93-2

CAS 1803581-93-2 is the registry number for Methyl 5-amino-2-bromobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2-bromobenzoate;hydrochloride (CAS 1803581-93-2) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: methyl 5-amino-2-bromobenzoate;hydrochloride. InChIKey: XOLXPFZLNOUDGV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BrClNO2
Molecular weight266.52 g/mol
IUPAC namemethyl 5-amino-2-bromobenzoate;hydrochloride
InChIKeyXOLXPFZLNOUDGV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)N)Br.Cl

Computed by PubChem (NCBI)