Products 297757-46-1
CAS 297757-46-1 appears in our catalog under these names: 7-Bromo-2,3-dihydro-1,4-benzodioxin-6-amine hydrochloride, 95%, 7-bromo-2,3-dihydro-1,4-benzodioxin-6-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
6-bromo-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride (CAS 297757-46-1) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride. InChIKey: PIDNBYQTPGNHRC-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride |
| InChIKey | PIDNBYQTPGNHRC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)N.Cl |
Computed by PubChem (NCBI)