Products 1048654-23-4
CAS 1048654-23-4 is the registry number for (R)-2-Amino-2-(4-bromophenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-2-(4-bromophenyl)acetic acid;hydrochloride (CAS 1048654-23-4) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: 2-amino-2-(4-bromophenyl)acetic acid;hydrochloride. InChIKey: WANQBUDPQVTWJW-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 2-amino-2-(4-bromophenyl)acetic acid;hydrochloride |
| InChIKey | WANQBUDPQVTWJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)