(S)-2-Aminopentanedioic acid hydrochloride, 98%
cas: 138-15-8 — see every product listed under this CAS number, including other names
(S)-2-Aminopentanedioic acid hydrochloride, 98% (CAS 138-15-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD18207-25g |
| cas | 138-15-8 |
| size | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 25g | 125.54 Pln | |
| BLDpharm | 100g | 136.64 Pln | |
| BLDpharm | 500g | 153.30 Pln | |
| BLDpharm | 1kg | 236.61 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 78.80 Pln | |
| Chemat | 500g | 182.40 Pln | |
| Chemat | 1kg | 251.60 Pln | |
| Fluorochem | 100g | 102.06 Pln | |
| Fluorochem | 500g | 206.20 Pln | |
| Fluorochem | 1kg | 351.98 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-aminopentanedioic acid;hydrochloride (CAS 138-15-8) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (2S)-2-aminopentanedioic acid;hydrochloride. InChIKey: RPAJSBKBKSSMLJ-DFWYDOINSA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (2S)-2-aminopentanedioic acid;hydrochloride |
| InChIKey | RPAJSBKBKSSMLJ-DFWYDOINSA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)