CAS 129902-07-4 appears in our catalog under these names: D-Asparagine methyl ester hydrochloride, 90%, D-Asparagine methyl ester hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 0,25g, 10g.
(3R)-3-amino-4-methoxy-4-oxobutanoic acid;hydrochloride (CAS 129902-07-4) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (3R)-3-amino-4-methoxy-4-oxobutanoic acid;hydrochloride. InChIKey: SCGWHMHVOQPGLS-AENDTGMFSA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (3R)-3-amino-4-methoxy-4-oxobutanoic acid;hydrochloride |
| InChIKey | SCGWHMHVOQPGLS-AENDTGMFSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)