Products 617-61-8
CAS 617-61-8 is the registry number for D-Glutamic acid hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 5g, 25g, 100g, 500g.
(2R)-2-aminopentanedioic acid;hydrochloride (CAS 617-61-8) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (2R)-2-aminopentanedioic acid;hydrochloride. InChIKey: RPAJSBKBKSSMLJ-AENDTGMFSA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (2R)-2-aminopentanedioic acid;hydrochloride |
| InChIKey | RPAJSBKBKSSMLJ-AENDTGMFSA-N |
| SMILES | C(CC(=O)O)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)