CAS 16856-13-6 appears in our catalog under these names: H–Asp(OMe)–OH·HCl, β-Methyl L-aspartate hydrochloride/ 99.55% (existing batch purity), H-L-Asp(OMe)-OH*HCl, L-Aspartic acid 4-methyl ester hydrochloride, 97% , L-Aspartic acid b-methyl ester hydrochloride. Offered by: GLPBio, TargetMol, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 50g, 5g, 25g, 1g, 0,1kg, 0,05kg, 25kg.
(2S)-2-amino-4-methoxy-4-oxobutanoic acid;hydrochloride (CAS 16856-13-6) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (2S)-2-amino-4-methoxy-4-oxobutanoic acid;hydrochloride. InChIKey: QRBMPUYOGOCYDJ-DFWYDOINSA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (2S)-2-amino-4-methoxy-4-oxobutanoic acid;hydrochloride |
| InChIKey | QRBMPUYOGOCYDJ-DFWYDOINSA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)