CAS 138-15-8 appears in our catalog under these names: L-Glutamic Acid Hydrochloride, L-Glutamic acid hydrochloride, 99% , L-(+)-Glutamic acid HCl, L(+)-Glutamic acid hydrochloride, 99%, L-Glutamic Acid Hydrochloride, >98.0%(HPLC)(T). Offered by: TRC, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 2,5g, 1000g, 250g, 5kg, 10kg, 2.5KG, 100g, 500g.
(2S)-2-aminopentanedioic acid;hydrochloride (CAS 138-15-8) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (2S)-2-aminopentanedioic acid;hydrochloride. InChIKey: RPAJSBKBKSSMLJ-DFWYDOINSA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (2S)-2-aminopentanedioic acid;hydrochloride |
| InChIKey | RPAJSBKBKSSMLJ-DFWYDOINSA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)