Products 201212-79-5
CAS 201212-79-5 is the registry number for H–D–Ser(Ac)–OH · HCl. Offered by: GLPBio. Available pack sizes: 5g, 1g.
(2R)-3-acetyloxy-2-aminopropanoic acid;hydrochloride (CAS 201212-79-5) is a chemical compound with the molecular formula C5H10ClNO4 and a molecular weight of 183.59 g/mol. IUPAC name: (2R)-3-acetyloxy-2-aminopropanoic acid;hydrochloride. InChIKey: MGQOSZSPKMBSRW-PGMHMLKASA-N.
| Molecular formula | C5H10ClNO4 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (2R)-3-acetyloxy-2-aminopropanoic acid;hydrochloride |
| InChIKey | MGQOSZSPKMBSRW-PGMHMLKASA-N |
| SMILES | CC(=O)OC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-D-Ser(Ac)-OH HCl, (R)-3-Acetoxy-2-aminopropanoic acid hydrochloride, (2R)-3-acetyloxy-2-aminopropanoic acid;hydrochloride, O-Acetyl-D-serine hydrochloride, H-D-Ser(ac)-oh hydrochloride, (2R)-3-acetoxy-2-amino-propanoic acid;hydrochloride, H-D-Ser(Ac)-OH inverted exclamation mark currencyHCl