cas: 2222165-17-3 — see every product listed under this CAS number, including other names
(S)-2-Methyl-1-(pyridin-2-yl)propan-1-amine dihydrochloride, 98% (CAS 2222165-17-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607593-50MG |
| cas | 2222165-17-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 857.01 Pln | |
| Fluorochem | 100mg | 1169.40 Pln | |
| Fluorochem | 250mg | 1762.94 Pln | |
| Fluorochem | 500mg | 3475.88 Pln | |
| Fluorochem | 1g | 5313.77 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride (CAS 2222165-17-3) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride. InChIKey: WQMCWVFMBPRHJX-WWPIYYJJSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride |
| InChIKey | WQMCWVFMBPRHJX-WWPIYYJJSA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)