cas: 2222165-17-3 — see every product listed under this CAS number, including other names
(S)-2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride, 97% (CAS 2222165-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A611613-250mg |
| cas | 2222165-17-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2817.22 Pln | |
| AmBeed | 100mg | 1866.76 Pln | |
| AmBeed | 1g | 8513.47 Pln | |
| AmBeed | 5g | 19248.46 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride (CAS 2222165-17-3) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride. InChIKey: WQMCWVFMBPRHJX-WWPIYYJJSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride |
| InChIKey | WQMCWVFMBPRHJX-WWPIYYJJSA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)