cas: 499995-76-5 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-methoxyphenyl)propanoic acid, 98% (CAS 499995-76-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD117585-100mg |
| cas | 499995-76-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 964.13 Pln | |
| BLDpharm | 5g | 3335.52 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3194.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-(2-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 499995-76-5) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (3S)-3-(2-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: HTVHHPNRENCUJY-NSHDSACASA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (3S)-3-(2-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | HTVHHPNRENCUJY-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC=C1OC |
Computed by PubChem (NCBI)