cas: 159415-52-8 — see every product listed under this CAS number, including other names
(S)-3-(3-Fluorophenyl)-2-hydroxypropionic Acid, 96%, 96% (CAS 159415-52-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYJ8-100mg |
| cas | 159415-52-8 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1192.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid (CAS 159415-52-8) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid. InChIKey: QPMLOIAOWWYEMI-QMMMGPOBSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | (2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid |
| InChIKey | QPMLOIAOWWYEMI-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)F)C[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)