cas: 159415-52-8 — see every product listed under this CAS number, including other names
(S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid, 96% (CAS 159415-52-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F770496-100MG |
| cas | 159415-52-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 3902.81 Pln | |
| Fluorochem | 10g | 4668.17 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid (CAS 159415-52-8) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid. InChIKey: QPMLOIAOWWYEMI-QMMMGPOBSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | (2S)-3-(3-fluorophenyl)-2-hydroxypropanoic acid |
| InChIKey | QPMLOIAOWWYEMI-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)F)C[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)